C25H29F3O6 — CID 59767509
[4-(trifluoromethoxy)phenyl] 4-[5-[(3-ethyloxetan-3-yl)methoxy]pentoxy]benzoate (PubChem CID 59767509) has the molecular formula C25H29F3O6 and a molecular weight of 482.50 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl] 4-[5-[(3-ethyloxetan-3-yl)methoxy]pentoxy]benzoate.
| Compound Name | [4-(trifluoromethoxy)phenyl] 4-[5-[(3-ethyloxetan-3-yl)methoxy]pentoxy]benzoate |
|---|---|
| PubChem CID | 59767509 |
| Molecular Formula | C25H29F3O6 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl] 4-[5-[(3-ethyloxetan-3-yl)methoxy]pentoxy]benzoate |
| SMILES | CCC1(COCCCCCOc2ccc(C(=O)Oc3ccc(OC(F)(F)F)cc3)cc2)COC1 |
| InChI | InChI=1S/C25H29F3O6/c1-2-24(17-31-18-24)16-30-14-4-3-5-15-32-20-8-6-19(7-9-20)23(29)33-21-10-12-22(13-11-21)34-25(26,27)28/h6-13H,2-5,14-18H2,1H3 |
| InChIKey | PYOPYFFRUHTCCV-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|