C31H33F3O6 — CID 59767593
[4-[4-(trifluoromethoxy)phenyl]phenyl] 4-[6-[(3-methyloxetan-3-yl)methoxy]hexoxy]benzoate (PubChem CID 59767593) has the molecular formula C31H33F3O6 and a molecular weight of 558.59 g/mol. Its IUPAC name is [4-[4-(trifluoromethoxy)phenyl]phenyl] 4-[6-[(3-methyloxetan-3-yl)methoxy]hexoxy]benzoate.
| Compound Name | [4-[4-(trifluoromethoxy)phenyl]phenyl] 4-[6-[(3-methyloxetan-3-yl)methoxy]hexoxy]benzoate |
|---|---|
| PubChem CID | 59767593 |
| Molecular Formula | C31H33F3O6 |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | [4-[4-(trifluoromethoxy)phenyl]phenyl] 4-[6-[(3-methyloxetan-3-yl)methoxy]hexoxy]benzoate |
| SMILES | CC1(COCCCCCCOc2ccc(C(=O)Oc3ccc(-c4ccc(OC(F)(F)F)cc4)cc3)cc2)COC1 |
| InChI | InChI=1S/C31H33F3O6/c1-30(21-37-22-30)20-36-18-4-2-3-5-19-38-26-12-10-25(11-13-26)29(35)39-27-14-6-23(7-15-27)24-8-16-28(17-9-24)40-31(32,33)34/h6-17H,2-5,18-22H2,1H3 |
| InChIKey | XZCANRQYJUKMJJ-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|