C42H43F3O8 — CID 58586858
[9,9-dimethyl-7-[4-(trifluoromethoxy)benzoyl]oxyfluoren-2-yl] 4-[6-[(3-ethyloxetan-3-yl)methoxy]hexoxy]benzoate (PubChem CID 58586858) has the molecular formula C42H43F3O8 and a molecular weight of 732.79 g/mol. Its IUPAC name is [9,9-dimethyl-7-[4-(trifluoromethoxy)benzoyl]oxyfluoren-2-yl] 4-[6-[(3-ethyloxetan-3-yl)methoxy]hexoxy]benzoate.
| Compound Name | [9,9-dimethyl-7-[4-(trifluoromethoxy)benzoyl]oxyfluoren-2-yl] 4-[6-[(3-ethyloxetan-3-yl)methoxy]hexoxy]benzoate |
|---|---|
| PubChem CID | 58586858 |
| Molecular Formula | C42H43F3O8 |
| Molecular Weight | 732.79 g/mol |
| Exact Mass | 732.29 |
| IUPAC Name | [9,9-dimethyl-7-[4-(trifluoromethoxy)benzoyl]oxyfluoren-2-yl] 4-[6-[(3-ethyloxetan-3-yl)methoxy]hexoxy]benzoate |
| SMILES | CCC1(COCCCCCCOc2ccc(C(=O)Oc3ccc4c(c3)C(C)(C)c3cc(OC(=O)c5ccc(OC(F)(F)F)cc5)ccc3-4)cc2)COC1 |
| InChI | InChI=1S/C42H43F3O8/c1-4-41(26-49-27-41)25-48-21-7-5-6-8-22-50-30-13-9-28(10-14-30)38(46)51-32-17-19-34-35-20-18-33(24-37(35)40(2,3)36(34)23-32)52-39(47)29-11-15-31(16-12-29)53-42(43,44)45/h9-20,23-24H,4-8,21-22,25-27H2,1-3H3 |
| InChIKey | OFUNSYFHYPDYPI-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.79 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|