C40H40F3NO7 — CID 58586800
[9-ethyl-7-[[4-(trifluoromethoxy)phenyl]carbamoyl]-9H-fluoren-2-yl] 4-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]benzoate (PubChem CID 58586800) has the molecular formula C40H40F3NO7 and a molecular weight of 703.75 g/mol. Its IUPAC name is [9-ethyl-7-[[4-(trifluoromethoxy)phenyl]carbamoyl]-9H-fluoren-2-yl] 4-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]benzoate.
| Compound Name | [9-ethyl-7-[[4-(trifluoromethoxy)phenyl]carbamoyl]-9H-fluoren-2-yl] 4-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]benzoate |
|---|---|
| PubChem CID | 58586800 |
| Molecular Formula | C40H40F3NO7 |
| Molecular Weight | 703.75 g/mol |
| Exact Mass | 703.28 |
| IUPAC Name | [9-ethyl-7-[[4-(trifluoromethoxy)phenyl]carbamoyl]-9H-fluoren-2-yl] 4-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]benzoate |
| SMILES | CCC1c2cc(OC(=O)c3ccc(OCCCCOCC4(CC)COC4)cc3)ccc2-c2ccc(C(=O)Nc3ccc(OC(F)(F)F)cc3)cc21 |
| InChI | InChI=1S/C40H40F3NO7/c1-3-32-35-21-27(37(45)44-28-10-14-30(15-11-28)51-40(41,42)43)9-17-33(35)34-18-16-31(22-36(32)34)50-38(46)26-7-12-29(13-8-26)49-20-6-5-19-47-23-39(4-2)24-48-25-39/h7-18,21-22,32H,3-6,19-20,23-25H2,1-2H3,(H,44,45) |
| InChIKey | SEKPUYNGGBIQAC-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.75 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|