C40H39NO7 — CID 89267574
[7-[4-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]benzoyl]oxy-9,9-dimethylfluoren-2-yl] 4-cyanobenzoate (PubChem CID 89267574) has the molecular formula C40H39NO7 and a molecular weight of 645.75 g/mol. Its IUPAC name is [7-[4-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]benzoyl]oxy-9,9-dimethylfluoren-2-yl] 4-cyanobenzoate.
| Compound Name | [7-[4-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]benzoyl]oxy-9,9-dimethylfluoren-2-yl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 89267574 |
| Molecular Formula | C40H39NO7 |
| Molecular Weight | 645.75 g/mol |
| Exact Mass | 645.27 |
| IUPAC Name | [7-[4-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]benzoyl]oxy-9,9-dimethylfluoren-2-yl] 4-cyanobenzoate |
| SMILES | CCC1(COCCCCOc2ccc(C(=O)Oc3ccc4c(c3)C(C)(C)c3cc(OC(=O)c5ccc(C#N)cc5)ccc3-4)cc2)COC1 |
| InChI | InChI=1S/C40H39NO7/c1-4-40(25-45-26-40)24-44-19-5-6-20-46-30-13-11-29(12-14-30)38(43)48-32-16-18-34-33-17-15-31(21-35(33)39(2,3)36(34)22-32)47-37(42)28-9-7-27(23-41)8-10-28/h7-18,21-22H,4-6,19-20,24-26H2,1-3H3 |
| InChIKey | HHERPAFDJNWCPL-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 104.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.75 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|