C53H62O14 — CID 157156197
[4-(2-prop-2-enoyloxyethoxy)phenyl] 4-[4-[(1-ethylcyclobutyl)methoxy]butoxy]benzoate;[4-(2-prop-2-enoyloxyethoxy)phenyl] 4-[(3-ethyloxetan-3-yl)methoxy]benzoate (PubChem CID 157156197) has the molecular formula C53H62O14 and a molecular weight of 923.06 g/mol. Its IUPAC name is [4-(2-prop-2-enoyloxyethoxy)phenyl] 4-[4-[(1-ethylcyclobutyl)methoxy]butoxy]benzoate;[4-(2-prop-2-enoyloxyethoxy)phenyl] 4-[(3-ethyloxetan-3-yl)methoxy]benzoate.
| Compound Name | [4-(2-prop-2-enoyloxyethoxy)phenyl] 4-[4-[(1-ethylcyclobutyl)methoxy]butoxy]benzoate;[4-(2-prop-2-enoyloxyethoxy)phenyl] 4-[(3-ethyloxetan-3-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 157156197 |
| Molecular Formula | C53H62O14 |
| Molecular Weight | 923.06 g/mol |
| Exact Mass | 922.41 |
| IUPAC Name | [4-(2-prop-2-enoyloxyethoxy)phenyl] 4-[4-[(1-ethylcyclobutyl)methoxy]butoxy]benzoate;[4-(2-prop-2-enoyloxyethoxy)phenyl] 4-[(3-ethyloxetan-3-yl)methoxy]benzoate |
| SMILES | C=CC(=O)OCCOc1ccc(OC(=O)c2ccc(OCC3(CC)COC3)cc2)cc1.C=CC(=O)OCCOc1ccc(OC(=O)c2ccc(OCCCCOCC3(CC)CCC3)cc2)cc1 |
| InChI | InChI=1S/C29H36O7.C24H26O7/c1-3-27(30)35-21-20-34-25-12-14-26(15-13-25)36-28(31)23-8-10-24(11-9-23)33-19-6-5-18-32-22-29(4-2)16-7-17-29;1-3-22(25)29-14-13-28-19-9-11-21(12-10-19)31-23(26)18-5-7-20(8-6-18)30-17-24(4-2)15-27-16-24/h3,8-15H,1,4-7,16-22H2,2H3;3,5-12H,1,4,13-17H2,2H3 |
| InChIKey | ALVJHAGABYYKJM-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 160.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.06 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|