C37H42O10 — CID 59762740
[4-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]phenyl] 2-methyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxybenzoate (PubChem CID 59762740) has the molecular formula C37H42O10 and a molecular weight of 646.73 g/mol. Its IUPAC name is [4-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]phenyl] 2-methyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxybenzoate.
| Compound Name | [4-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]phenyl] 2-methyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxybenzoate |
|---|---|
| PubChem CID | 59762740 |
| Molecular Formula | C37H42O10 |
| Molecular Weight | 646.73 g/mol |
| Exact Mass | 646.28 |
| IUPAC Name | [4-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]phenyl] 2-methyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxybenzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(OCCCCOCC4(C)COC4)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C37H42O10/c1-4-34(38)45-22-8-7-21-43-29-11-9-28(10-12-29)35(39)47-32-17-18-33(27(2)23-32)36(40)46-31-15-13-30(14-16-31)44-20-6-5-19-41-24-37(3)25-42-26-37/h4,9-18,23H,1,5-8,19-22,24-26H2,2-3H3 |
| InChIKey | YZDQMEFAHMFLFE-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.73 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|