C38H48O11 — CID 159775497
[4-(methoxymethoxy)phenyl] 4-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]benzoate;2-[2-(4-methylphenoxy)ethoxy]ethyl prop-2-enoate (PubChem CID 159775497) has the molecular formula C38H48O11 and a molecular weight of 680.79 g/mol. Its IUPAC name is [4-(methoxymethoxy)phenyl] 4-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]benzoate;2-[2-(4-methylphenoxy)ethoxy]ethyl prop-2-enoate.
| Compound Name | [4-(methoxymethoxy)phenyl] 4-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]benzoate;2-[2-(4-methylphenoxy)ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 159775497 |
| Molecular Formula | C38H48O11 |
| Molecular Weight | 680.79 g/mol |
| Exact Mass | 680.32 |
| IUPAC Name | [4-(methoxymethoxy)phenyl] 4-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]benzoate;2-[2-(4-methylphenoxy)ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCOc1ccc(C)cc1.COCOc1ccc(OC(=O)c2ccc(OCCCCOCC3(C)COC3)cc2)cc1 |
| InChI | InChI=1S/C24H30O7.C14H18O4/c1-24(16-28-17-24)15-27-13-3-4-14-29-20-7-5-19(6-8-20)23(25)31-22-11-9-21(10-12-22)30-18-26-2;1-3-14(15)18-11-9-16-8-10-17-13-6-4-12(2)5-7-13/h5-12H,3-4,13-18H2,1-2H3;3-7H,1,8-11H2,2H3 |
| InChIKey | NGRJTHFFSBONGZ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 117.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.79 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|