C32H44O11 — CID 20789540
[4-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 20789540) has the molecular formula C32H44O11 and a molecular weight of 604.69 g/mol. Its IUPAC name is [4-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [4-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 20789540 |
| Molecular Formula | C32H44O11 |
| Molecular Weight | 604.69 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | [4-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OCCOCCOCCOCCOCCO)cc2)cc1 |
| InChI | InChI=1S/C32H44O11/c1-2-31(34)42-17-6-4-3-5-16-40-28-9-7-27(8-10-28)32(35)43-30-13-11-29(12-14-30)41-26-25-39-24-23-38-22-21-37-20-19-36-18-15-33/h2,7-14,33H,1,3-6,15-26H2 |
| InChIKey | MGZSNNKTRFQDNZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.69 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|