C34H39BrO6 — CID 102233914
[4-(6-prop-2-enoyloxyhexoxy)phenyl] 4-[4-(6-bromohexoxy)phenyl]benzoate (PubChem CID 102233914) has the molecular formula C34H39BrO6 and a molecular weight of 623.58 g/mol. Its IUPAC name is [4-(6-prop-2-enoyloxyhexoxy)phenyl] 4-[4-(6-bromohexoxy)phenyl]benzoate.
| Compound Name | [4-(6-prop-2-enoyloxyhexoxy)phenyl] 4-[4-(6-bromohexoxy)phenyl]benzoate |
|---|---|
| PubChem CID | 102233914 |
| Molecular Formula | C34H39BrO6 |
| Molecular Weight | 623.58 g/mol |
| Exact Mass | 622.19 |
| IUPAC Name | [4-(6-prop-2-enoyloxyhexoxy)phenyl] 4-[4-(6-bromohexoxy)phenyl]benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(OC(=O)c2ccc(-c3ccc(OCCCCCCBr)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H39BrO6/c1-2-33(36)40-26-10-6-5-9-25-39-31-19-21-32(22-20-31)41-34(37)29-13-11-27(12-14-29)28-15-17-30(18-16-28)38-24-8-4-3-7-23-35/h2,11-22H,1,3-10,23-26H2 |
| InChIKey | DQTTXSHABXEEQU-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.58 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|