C36H42O10 — CID 59741740
[4-[[4-(4-prop-2-enoyloxybutoxy)phenoxy]methoxy]phenyl] 4-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]benzoate (PubChem CID 59741740) has the molecular formula C36H42O10 and a molecular weight of 634.72 g/mol. Its IUPAC name is [4-[[4-(4-prop-2-enoyloxybutoxy)phenoxy]methoxy]phenyl] 4-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]benzoate.
| Compound Name | [4-[[4-(4-prop-2-enoyloxybutoxy)phenoxy]methoxy]phenyl] 4-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]benzoate |
|---|---|
| PubChem CID | 59741740 |
| Molecular Formula | C36H42O10 |
| Molecular Weight | 634.72 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | [4-[[4-(4-prop-2-enoyloxybutoxy)phenoxy]methoxy]phenyl] 4-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(OCOc2ccc(OC(=O)c3ccc(OCCCCOCC4(C)COC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H42O10/c1-3-34(37)43-23-7-6-22-42-30-12-14-31(15-13-30)44-27-45-32-16-18-33(19-17-32)46-35(38)28-8-10-29(11-9-28)41-21-5-4-20-39-24-36(2)25-40-26-36/h3,8-19H,1,4-7,20-27H2,2H3 |
| InChIKey | SPHZTSPSYBZVLY-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.72 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|