C52H60O10 — CID 89417628
[4-[4-ethyl-1-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl]cyclohexyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 89417628) has the molecular formula C52H60O10 and a molecular weight of 845.04 g/mol. Its IUPAC name is [4-[4-ethyl-1-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl]cyclohexyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [4-[4-ethyl-1-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl]cyclohexyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 89417628 |
| Molecular Formula | C52H60O10 |
| Molecular Weight | 845.04 g/mol |
| Exact Mass | 844.42 |
| IUPAC Name | [4-[4-ethyl-1-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl]cyclohexyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(C3(c4ccc(OC(=O)c5ccc(OCCCCCCOC(=O)C=C)cc5)cc4)CCC(CC)CC3)cc2)cc1 |
| InChI | InChI=1S/C52H60O10/c1-4-39-31-33-52(34-32-39,42-19-27-46(28-20-42)61-50(55)40-15-23-44(24-16-40)57-35-11-7-9-13-37-59-48(53)5-2)43-21-29-47(30-22-43)62-51(56)41-17-25-45(26-18-41)58-36-12-8-10-14-38-60-49(54)6-3/h5-6,15-30,39H,2-4,7-14,31-38H2,1H3 |
| InChIKey | DQCPWRDHXNANJQ-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.04 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|