C37H33F3O8 — CID 58586871
[9,9-dimethyl-7-[4-(trifluoromethoxy)benzoyl]oxyfluoren-2-yl] 4-[4-(oxiran-2-ylmethoxy)butoxy]benzoate (PubChem CID 58586871) has the molecular formula C37H33F3O8 and a molecular weight of 662.66 g/mol. Its IUPAC name is [9,9-dimethyl-7-[4-(trifluoromethoxy)benzoyl]oxyfluoren-2-yl] 4-[4-(oxiran-2-ylmethoxy)butoxy]benzoate.
| Compound Name | [9,9-dimethyl-7-[4-(trifluoromethoxy)benzoyl]oxyfluoren-2-yl] 4-[4-(oxiran-2-ylmethoxy)butoxy]benzoate |
|---|---|
| PubChem CID | 58586871 |
| Molecular Formula | C37H33F3O8 |
| Molecular Weight | 662.66 g/mol |
| Exact Mass | 662.21 |
| IUPAC Name | [9,9-dimethyl-7-[4-(trifluoromethoxy)benzoyl]oxyfluoren-2-yl] 4-[4-(oxiran-2-ylmethoxy)butoxy]benzoate |
| SMILES | CC1(C)c2cc(OC(=O)c3ccc(OCCCCOCC4CO4)cc3)ccc2-c2ccc(OC(=O)c3ccc(OC(F)(F)F)cc3)cc21 |
| InChI | InChI=1S/C37H33F3O8/c1-36(2)32-19-27(46-34(41)23-5-9-25(10-6-23)44-18-4-3-17-43-21-29-22-45-29)13-15-30(32)31-16-14-28(20-33(31)36)47-35(42)24-7-11-26(12-8-24)48-37(38,39)40/h5-16,19-20,29H,3-4,17-18,21-22H2,1-2H3 |
| InChIKey | YKYIWTOBXHDJTN-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 92.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.66 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|