C28H23F5O6 — CID 58586898
[9,9-difluoro-7-(trifluoromethoxy)fluoren-2-yl] 4-[4-(oxiran-2-ylmethoxy)butoxy]benzoate (PubChem CID 58586898) has the molecular formula C28H23F5O6 and a molecular weight of 550.48 g/mol. Its IUPAC name is [9,9-difluoro-7-(trifluoromethoxy)fluoren-2-yl] 4-[4-(oxiran-2-ylmethoxy)butoxy]benzoate.
| Compound Name | [9,9-difluoro-7-(trifluoromethoxy)fluoren-2-yl] 4-[4-(oxiran-2-ylmethoxy)butoxy]benzoate |
|---|---|
| PubChem CID | 58586898 |
| Molecular Formula | C28H23F5O6 |
| Molecular Weight | 550.48 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | [9,9-difluoro-7-(trifluoromethoxy)fluoren-2-yl] 4-[4-(oxiran-2-ylmethoxy)butoxy]benzoate |
| SMILES | O=C(Oc1ccc2c(c1)C(F)(F)c1cc(OC(F)(F)F)ccc1-2)c1ccc(OCCCCOCC2CO2)cc1 |
| InChI | InChI=1S/C28H23F5O6/c29-27(30)24-13-19(7-9-22(24)23-10-8-20(14-25(23)27)39-28(31,32)33)38-26(34)17-3-5-18(6-4-17)36-12-2-1-11-35-15-21-16-37-21/h3-10,13-14,21H,1-2,11-12,15-16H2 |
| InChIKey | MKSWCSRARKJWCQ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.48 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|