C37H30F6O7 — CID 58586939
[7-[4-(1,1,2,3,3,3-hexafluoropropoxy)benzoyl]oxy-9H-fluoren-2-yl] 4-[5-(oxiran-2-yl)pentoxy]benzoate (PubChem CID 58586939) has the molecular formula C37H30F6O7 and a molecular weight of 700.63 g/mol. Its IUPAC name is [7-[4-(1,1,2,3,3,3-hexafluoropropoxy)benzoyl]oxy-9H-fluoren-2-yl] 4-[5-(oxiran-2-yl)pentoxy]benzoate.
| Compound Name | [7-[4-(1,1,2,3,3,3-hexafluoropropoxy)benzoyl]oxy-9H-fluoren-2-yl] 4-[5-(oxiran-2-yl)pentoxy]benzoate |
|---|---|
| PubChem CID | 58586939 |
| Molecular Formula | C37H30F6O7 |
| Molecular Weight | 700.63 g/mol |
| Exact Mass | 700.19 |
| IUPAC Name | [7-[4-(1,1,2,3,3,3-hexafluoropropoxy)benzoyl]oxy-9H-fluoren-2-yl] 4-[5-(oxiran-2-yl)pentoxy]benzoate |
| SMILES | O=C(Oc1ccc2c(c1)Cc1cc(OC(=O)c3ccc(OC(F)(F)C(F)C(F)(F)F)cc3)ccc1-2)c1ccc(OCCCCCC2CO2)cc1 |
| InChI | InChI=1S/C37H30F6O7/c38-35(36(39,40)41)37(42,43)50-27-11-7-23(8-12-27)34(45)49-29-14-16-32-25(20-29)18-24-19-28(13-15-31(24)32)48-33(44)22-5-9-26(10-6-22)46-17-3-1-2-4-30-21-47-30/h5-16,19-20,30,35H,1-4,17-18,21H2 |
| InChIKey | XFAPOVQTKBLCKT-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 83.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.63 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|