C26H21F3O5 — CID 58586769
[9-methyl-7-(trifluoromethoxy)-9H-fluoren-2-yl] 4-[2-(oxiran-2-yl)ethoxy]benzoate (PubChem CID 58586769) has the molecular formula C26H21F3O5 and a molecular weight of 470.44 g/mol. Its IUPAC name is [9-methyl-7-(trifluoromethoxy)-9H-fluoren-2-yl] 4-[2-(oxiran-2-yl)ethoxy]benzoate.
| Compound Name | [9-methyl-7-(trifluoromethoxy)-9H-fluoren-2-yl] 4-[2-(oxiran-2-yl)ethoxy]benzoate |
|---|---|
| PubChem CID | 58586769 |
| Molecular Formula | C26H21F3O5 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | [9-methyl-7-(trifluoromethoxy)-9H-fluoren-2-yl] 4-[2-(oxiran-2-yl)ethoxy]benzoate |
| SMILES | CC1c2cc(OC(=O)c3ccc(OCCC4CO4)cc3)ccc2-c2ccc(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C26H21F3O5/c1-15-23-12-18(6-8-21(23)22-9-7-19(13-24(15)22)34-26(27,28)29)33-25(30)16-2-4-17(5-3-16)31-11-10-20-14-32-20/h2-9,12-13,15,20H,10-11,14H2,1H3 |
| InChIKey | TVQSOHGOUWMRKC-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|