C44H48O8 — CID 59318843
[9-methyl-7-[4-[6-(oxiran-2-yl)hexoxy]benzoyl]oxy-9H-fluoren-2-yl] 4-[6-(oxiran-2-yl)hexoxy]benzoate (PubChem CID 59318843) has the molecular formula C44H48O8 and a molecular weight of 704.86 g/mol. Its IUPAC name is [9-methyl-7-[4-[6-(oxiran-2-yl)hexoxy]benzoyl]oxy-9H-fluoren-2-yl] 4-[6-(oxiran-2-yl)hexoxy]benzoate.
| Compound Name | [9-methyl-7-[4-[6-(oxiran-2-yl)hexoxy]benzoyl]oxy-9H-fluoren-2-yl] 4-[6-(oxiran-2-yl)hexoxy]benzoate |
|---|---|
| PubChem CID | 59318843 |
| Molecular Formula | C44H48O8 |
| Molecular Weight | 704.86 g/mol |
| Exact Mass | 704.33 |
| IUPAC Name | [9-methyl-7-[4-[6-(oxiran-2-yl)hexoxy]benzoyl]oxy-9H-fluoren-2-yl] 4-[6-(oxiran-2-yl)hexoxy]benzoate |
| SMILES | CC1c2cc(OC(=O)c3ccc(OCCCCCCC4CO4)cc3)ccc2-c2ccc(OC(=O)c3ccc(OCCCCCCC4CO4)cc3)cc21 |
| InChI | InChI=1S/C44H48O8/c1-30-41-26-35(51-43(45)31-12-16-33(17-13-31)47-24-8-4-2-6-10-37-28-49-37)20-22-39(41)40-23-21-36(27-42(30)40)52-44(46)32-14-18-34(19-15-32)48-25-9-5-3-7-11-38-29-50-38/h12-23,26-27,30,37-38H,2-11,24-25,28-29H2,1H3 |
| InChIKey | HWTKMFPJFHYUNR-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.86 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|