C35H40O9 — CID 58895340
4-(oxiran-2-yl)butyl 2,5-bis[(4-butoxybenzoyl)oxy]benzoate (PubChem CID 58895340) has the molecular formula C35H40O9 and a molecular weight of 604.70 g/mol. Its IUPAC name is 4-(oxiran-2-yl)butyl 2,5-bis[(4-butoxybenzoyl)oxy]benzoate.
| Compound Name | 4-(oxiran-2-yl)butyl 2,5-bis[(4-butoxybenzoyl)oxy]benzoate |
|---|---|
| PubChem CID | 58895340 |
| Molecular Formula | C35H40O9 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | 4-(oxiran-2-yl)butyl 2,5-bis[(4-butoxybenzoyl)oxy]benzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCC)cc3)c(C(=O)OCCCCC3CO3)c2)cc1 |
| InChI | InChI=1S/C35H40O9/c1-3-5-20-39-27-14-10-25(11-15-27)33(36)43-29-18-19-32(31(23-29)35(38)41-22-8-7-9-30-24-42-30)44-34(37)26-12-16-28(17-13-26)40-21-6-4-2/h10-19,23,30H,3-9,20-22,24H2,1-2H3 |
| InChIKey | DJOHTRYZAZUBPX-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 109.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|