C46H54O10 — CID 91941191
2-(4-formylphenoxy)ethyl 2,5-bis[(4-octoxybenzoyl)oxy]benzoate (PubChem CID 91941191) has the molecular formula C46H54O10 and a molecular weight of 766.93 g/mol. Its IUPAC name is 2-(4-formylphenoxy)ethyl 2,5-bis[(4-octoxybenzoyl)oxy]benzoate.
| Compound Name | 2-(4-formylphenoxy)ethyl 2,5-bis[(4-octoxybenzoyl)oxy]benzoate |
|---|---|
| PubChem CID | 91941191 |
| Molecular Formula | C46H54O10 |
| Molecular Weight | 766.93 g/mol |
| Exact Mass | 766.37 |
| IUPAC Name | 2-(4-formylphenoxy)ethyl 2,5-bis[(4-octoxybenzoyl)oxy]benzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCCCCC)cc3)c(C(=O)OCCOc3ccc(C=O)cc3)c2)cc1 |
| InChI | InChI=1S/C46H54O10/c1-3-5-7-9-11-13-29-51-39-23-17-36(18-24-39)44(48)55-41-27-28-43(42(33-41)46(50)54-32-31-53-38-21-15-35(34-47)16-22-38)56-45(49)37-19-25-40(26-20-37)52-30-14-12-10-8-6-4-2/h15-28,33-34H,3-14,29-32H2,1-2H3 |
| InChIKey | ADJNVZHOAFIYAO-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.93 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|