C51H64O11 — CID 102000231
2-(4-pentan-2-yloxycarbonylphenoxy)ethyl 2,5-bis[(4-octoxybenzoyl)oxy]benzoate (PubChem CID 102000231) has the molecular formula C51H64O11 and a molecular weight of 853.06 g/mol. Its IUPAC name is 2-(4-pentan-2-yloxycarbonylphenoxy)ethyl 2,5-bis[(4-octoxybenzoyl)oxy]benzoate.
| Compound Name | 2-(4-pentan-2-yloxycarbonylphenoxy)ethyl 2,5-bis[(4-octoxybenzoyl)oxy]benzoate |
|---|---|
| PubChem CID | 102000231 |
| Molecular Formula | C51H64O11 |
| Molecular Weight | 853.06 g/mol |
| Exact Mass | 852.44 |
| IUPAC Name | 2-(4-pentan-2-yloxycarbonylphenoxy)ethyl 2,5-bis[(4-octoxybenzoyl)oxy]benzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCCCCC)cc3)c(C(=O)OCCOc3ccc(C(=O)OC(C)CCC)cc3)c2)cc1 |
| InChI | InChI=1S/C51H64O11/c1-5-8-10-12-14-16-33-56-42-25-21-40(22-26-42)49(53)61-45-31-32-47(62-50(54)41-23-27-43(28-24-41)57-34-17-15-13-11-9-6-2)46(37-45)51(55)59-36-35-58-44-29-19-39(20-30-44)48(52)60-38(4)18-7-3/h19-32,37-38H,5-18,33-36H2,1-4H3 |
| InChIKey | GGLWRLFOZPUIAS-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.06 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|