C43H48O7 — CID 58586870
[9-methyl-7-[4-(4-prop-2-enoxybutoxy)benzoyl]oxy-9H-fluoren-2-yl] 4-octoxybenzoate (PubChem CID 58586870) has the molecular formula C43H48O7 and a molecular weight of 676.85 g/mol. Its IUPAC name is [9-methyl-7-[4-(4-prop-2-enoxybutoxy)benzoyl]oxy-9H-fluoren-2-yl] 4-octoxybenzoate.
| Compound Name | [9-methyl-7-[4-(4-prop-2-enoxybutoxy)benzoyl]oxy-9H-fluoren-2-yl] 4-octoxybenzoate |
|---|---|
| PubChem CID | 58586870 |
| Molecular Formula | C43H48O7 |
| Molecular Weight | 676.85 g/mol |
| Exact Mass | 676.34 |
| IUPAC Name | [9-methyl-7-[4-(4-prop-2-enoxybutoxy)benzoyl]oxy-9H-fluoren-2-yl] 4-octoxybenzoate |
| SMILES | C=CCOCCCCOc1ccc(C(=O)Oc2ccc3c(c2)C(C)c2cc(OC(=O)c4ccc(OCCCCCCCC)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C43H48O7/c1-4-6-7-8-9-10-27-47-34-17-13-32(14-18-34)42(44)49-36-21-23-38-39-24-22-37(30-41(39)31(3)40(38)29-36)50-43(45)33-15-19-35(20-16-33)48-28-12-11-26-46-25-5-2/h5,13-24,29-31H,2,4,6-12,25-28H2,1,3H3 |
| InChIKey | KDTNPPPCXIGGBR-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.85 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|