C36H31NO6 — CID 89267613
[9-methyl-7-[4-(4-prop-2-enoxybutoxy)benzoyl]oxy-9H-fluoren-2-yl] 4-cyanobenzoate (PubChem CID 89267613) has the molecular formula C36H31NO6 and a molecular weight of 573.65 g/mol. Its IUPAC name is [9-methyl-7-[4-(4-prop-2-enoxybutoxy)benzoyl]oxy-9H-fluoren-2-yl] 4-cyanobenzoate.
| Compound Name | [9-methyl-7-[4-(4-prop-2-enoxybutoxy)benzoyl]oxy-9H-fluoren-2-yl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 89267613 |
| Molecular Formula | C36H31NO6 |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | [9-methyl-7-[4-(4-prop-2-enoxybutoxy)benzoyl]oxy-9H-fluoren-2-yl] 4-cyanobenzoate |
| SMILES | C=CCOCCCCOc1ccc(C(=O)Oc2ccc3c(c2)C(C)c2cc(OC(=O)c4ccc(C#N)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C36H31NO6/c1-3-18-40-19-4-5-20-41-28-12-10-27(11-13-28)36(39)43-30-15-17-32-31-16-14-29(21-33(31)24(2)34(32)22-30)42-35(38)26-8-6-25(23-37)7-9-26/h3,6-17,21-22,24H,1,4-5,18-20H2,2H3 |
| InChIKey | OGVWDBYFNSRSKF-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|