C42H43NO9 — CID 22709074
2-[6-[4-(4-cyanophenyl)phenoxy]hexoxy]-5-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxybenzoic acid (PubChem CID 22709074) has the molecular formula C42H43NO9 and a molecular weight of 705.80 g/mol. Its IUPAC name is 2-[6-[4-(4-cyanophenyl)phenoxy]hexoxy]-5-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxybenzoic acid.
| Compound Name | 2-[6-[4-(4-cyanophenyl)phenoxy]hexoxy]-5-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 22709074 |
| Molecular Formula | C42H43NO9 |
| Molecular Weight | 705.80 g/mol |
| Exact Mass | 705.29 |
| IUPAC Name | 2-[6-[4-(4-cyanophenyl)phenoxy]hexoxy]-5-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxybenzoic acid |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OCCCCCCOc3ccc(-c4ccc(C#N)cc4)cc3)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C42H43NO9/c1-2-40(44)51-28-10-6-4-8-26-49-36-21-17-34(18-22-36)42(47)52-37-23-24-39(38(29-37)41(45)46)50-27-9-5-3-7-25-48-35-19-15-33(16-20-35)32-13-11-31(30-43)12-14-32/h2,11-24,29H,1,3-10,25-28H2,(H,45,46) |
| InChIKey | MIIRTUFSPBVJKN-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 141.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.80 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|