C32H29NO9 — CID 90870909
2-(4-cyanobenzoyl)oxy-5-[4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoyl]oxybenzoic acid (PubChem CID 90870909) has the molecular formula C32H29NO9 and a molecular weight of 571.58 g/mol. Its IUPAC name is 2-(4-cyanobenzoyl)oxy-5-[4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoyl]oxybenzoic acid.
| Compound Name | 2-(4-cyanobenzoyl)oxy-5-[4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 90870909 |
| Molecular Formula | C32H29NO9 |
| Molecular Weight | 571.58 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 2-(4-cyanobenzoyl)oxy-5-[4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoyl]oxybenzoic acid |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(C#N)cc3)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C32H29NO9/c1-21(2)30(36)40-18-6-4-3-5-17-39-25-13-11-24(12-14-25)31(37)41-26-15-16-28(27(19-26)29(34)35)42-32(38)23-9-7-22(20-33)8-10-23/h7-16,19H,1,3-6,17-18H2,2H3,(H,34,35) |
| InChIKey | GZVHYGSNLVPKLL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 149.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.58 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|