C26H32N2O5 — CID 70363951
4-aminobenzonitrile;4-[8-(2-methylprop-2-enoyloxy)octoxy]benzoic acid (PubChem CID 70363951) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is 4-aminobenzonitrile;4-[8-(2-methylprop-2-enoyloxy)octoxy]benzoic acid.
| Compound Name | 4-aminobenzonitrile;4-[8-(2-methylprop-2-enoyloxy)octoxy]benzoic acid |
|---|---|
| PubChem CID | 70363951 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 4-aminobenzonitrile;4-[8-(2-methylprop-2-enoyloxy)octoxy]benzoic acid |
| SMILES | C=C(C)C(=O)OCCCCCCCCOc1ccc(C(=O)O)cc1.N#Cc1ccc(N)cc1 |
| InChI | InChI=1S/C19H26O5.C7H6N2/c1-15(2)19(22)24-14-8-6-4-3-5-7-13-23-17-11-9-16(10-12-17)18(20)21;8-5-6-1-3-7(9)4-2-6/h9-12H,1,3-8,13-14H2,2H3,(H,20,21);1-4H,9H2 |
| InChIKey | WYTCCWLTVQUFQB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 122.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|