C21H34O5 — CID 145290925
ethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid (PubChem CID 145290925) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is ethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid.
| Compound Name | ethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid |
|---|---|
| PubChem CID | 145290925 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | ethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(C(=O)O)cc1.CC.CC |
| InChI | InChI=1S/C17H22O5.2C2H6/c1-13(2)17(20)22-12-6-4-3-5-11-21-15-9-7-14(8-10-15)16(18)19;2*1-2/h7-10H,1,3-6,11-12H2,2H3,(H,18,19);2*1-2H3 |
| InChIKey | XITBUGWHUGJESJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|