ethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid

C21H34O5 — CID 145290925

IUPACethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid
SMILESC=C(C)C(=O)OCCCCCCOc1ccc(C(=O)O)cc1.CC.CC
InChIInChI=1S/C17H22O5.2C2H6/c1-13(2)17(20)22-12-6-4-3-5-11-21-15-9-7-14(8-10-15)16(18)19;2*1-2/h7-10H,1,3-6,11-12H2,2H3,(H,18,19);2*1-2H3
InChIKeyXITBUGWHUGJESJ-UHFFFAOYSA-N
MW366.50 g/mol
LogP5.50
Rot. Bonds10

About ethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid

ethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid (PubChem CID 145290925) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is ethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid.

Molecular Properties

Compound Nameethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid
PubChem CID145290925
Molecular FormulaC21H34O5
Molecular Weight366.50 g/mol
Exact Mass366.24
IUPAC Nameethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid
SMILESC=C(C)C(=O)OCCCCCCOc1ccc(C(=O)O)cc1.CC.CC
InChIInChI=1S/C17H22O5.2C2H6/c1-13(2)17(20)22-12-6-4-3-5-11-21-15-9-7-14(8-10-15)16(18)19;2*1-2/h7-10H,1,3-6,11-12H2,2H3,(H,18,19);2*1-2H3
InChIKeyXITBUGWHUGJESJ-UHFFFAOYSA-N
XLogP5.50
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms26
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500366.50
LogP ≤ 55.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze ethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid?
The IUPAC name of ethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid (CID 145290925) is ethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid.
What is the SMILES notation for ethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid?
The canonical SMILES for ethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid is C=C(C)C(=O)OCCCCCCOc1ccc(C(=O)O)cc1.CC.CC.
What is the InChIKey of ethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid?
The InChIKey is XITBUGWHUGJESJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O5.2C2H6/c1-13(2)17(20)22-12-6-4-3-5-11-21-15-9-7-14(8-10-15)16(18)19;2*1-2/h7-10H,1,3-6,11-12H2,2H3,(H,18,19);2*1-2H3.
What are the key properties of ethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid?
ethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid has a molecular weight of 366.50 g/mol, XLogP of 5.50, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid is sourced from PubChem (CID 145290925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).