C29H32O5 — CID 162035072
benzoic acid;6-(4-phenylphenoxy)hexyl 2-methylprop-2-enoate (PubChem CID 162035072) has the molecular formula C29H32O5 and a molecular weight of 460.57 g/mol. Its IUPAC name is benzoic acid;6-(4-phenylphenoxy)hexyl 2-methylprop-2-enoate.
| Compound Name | benzoic acid;6-(4-phenylphenoxy)hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 162035072 |
| Molecular Formula | C29H32O5 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | benzoic acid;6-(4-phenylphenoxy)hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(-c2ccccc2)cc1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C22H26O3.C7H6O2/c1-18(2)22(23)25-17-9-4-3-8-16-24-21-14-12-20(13-15-21)19-10-6-5-7-11-19;8-7(9)6-4-2-1-3-5-6/h5-7,10-15H,1,3-4,8-9,16-17H2,2H3;1-5H,(H,8,9) |
| InChIKey | YWNQSGLXWVZWTD-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|