C40H46O6S2 — CID 59207320
6-[4-[5-[5-[4-[6-(2-methylprop-2-enoyloxy)hexoxy]phenyl]thiophen-2-yl]thiophen-2-yl]phenoxy]hexyl 2-methylprop-2-enoate (PubChem CID 59207320) has the molecular formula C40H46O6S2 and a molecular weight of 686.94 g/mol. Its IUPAC name is 6-[4-[5-[5-[4-[6-(2-methylprop-2-enoyloxy)hexoxy]phenyl]thiophen-2-yl]thiophen-2-yl]phenoxy]hexyl 2-methylprop-2-enoate.
| Compound Name | 6-[4-[5-[5-[4-[6-(2-methylprop-2-enoyloxy)hexoxy]phenyl]thiophen-2-yl]thiophen-2-yl]phenoxy]hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59207320 |
| Molecular Formula | C40H46O6S2 |
| Molecular Weight | 686.94 g/mol |
| Exact Mass | 686.27 |
| IUPAC Name | 6-[4-[5-[5-[4-[6-(2-methylprop-2-enoyloxy)hexoxy]phenyl]thiophen-2-yl]thiophen-2-yl]phenoxy]hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(-c2ccc(-c3ccc(-c4ccc(OCCCCCCOC(=O)C(=C)C)cc4)s3)s2)cc1 |
| InChI | InChI=1S/C40H46O6S2/c1-29(2)39(41)45-27-11-7-5-9-25-43-33-17-13-31(14-18-33)35-21-23-37(47-35)38-24-22-36(48-38)32-15-19-34(20-16-32)44-26-10-6-8-12-28-46-40(42)30(3)4/h13-24H,1,3,5-12,25-28H2,2,4H3 |
| InChIKey | CRWZGXMMKJYROL-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.94 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|