C23H28N2O4 — CID 101466134
5-[4-[(4-ethoxyphenyl)diazenyl]phenoxy]pentyl 2-methylprop-2-enoate (PubChem CID 101466134) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 5-[4-[(4-ethoxyphenyl)diazenyl]phenoxy]pentyl 2-methylprop-2-enoate.
| Compound Name | 5-[4-[(4-ethoxyphenyl)diazenyl]phenoxy]pentyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 101466134 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 5-[4-[(4-ethoxyphenyl)diazenyl]phenoxy]pentyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCOc1ccc(/N=N/c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-4-27-21-12-8-19(9-13-21)24-25-20-10-14-22(15-11-20)28-16-6-5-7-17-29-23(26)18(2)3/h8-15H,2,4-7,16-17H2,1,3H3/b25-24+ |
| InChIKey | GRUMXJKXLBCLTF-OCOZRVBESA-N |
| XLogP | 6.17 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|