C31H37N3O7 — CID 102039572
(2,5-dioxopyrrolidin-1-yl) 4-[[4-[10-(2-methylprop-2-enoyloxy)decoxy]phenyl]diazenyl]benzoate (PubChem CID 102039572) has the molecular formula C31H37N3O7 and a molecular weight of 563.65 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[[4-[10-(2-methylprop-2-enoyloxy)decoxy]phenyl]diazenyl]benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[[4-[10-(2-methylprop-2-enoyloxy)decoxy]phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 102039572 |
| Molecular Formula | C31H37N3O7 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[[4-[10-(2-methylprop-2-enoyloxy)decoxy]phenyl]diazenyl]benzoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCOc1ccc(/N=N/c2ccc(C(=O)ON3C(=O)CCC3=O)cc2)cc1 |
| InChI | InChI=1S/C31H37N3O7/c1-23(2)30(37)40-22-10-8-6-4-3-5-7-9-21-39-27-17-15-26(16-18-27)33-32-25-13-11-24(12-14-25)31(38)41-34-28(35)19-20-29(34)36/h11-18H,1,3-10,19-22H2,2H3/b33-32+ |
| InChIKey | SZORTDCHHWHDLZ-ULIFNZDWSA-N |
| XLogP | 6.94 |
| TPSA | 123.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|