C24H27NO5 — CID 19969049
(2,5-dioxopyrrolidin-1-yl) 4-(4-heptoxyphenyl)benzoate (PubChem CID 19969049) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-(4-heptoxyphenyl)benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-(4-heptoxyphenyl)benzoate |
|---|---|
| PubChem CID | 19969049 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(4-heptoxyphenyl)benzoate |
| SMILES | CCCCCCCOc1ccc(-c2ccc(C(=O)ON3C(=O)CCC3=O)cc2)cc1 |
| InChI | InChI=1S/C24H27NO5/c1-2-3-4-5-6-17-29-21-13-11-19(12-14-21)18-7-9-20(10-8-18)24(28)30-25-22(26)15-16-23(25)27/h7-14H,2-6,15-17H2,1H3 |
| InChIKey | GIDUVQQLGPFMFW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|