C37H44O12 — CID 135244375
[(3R,6R)-6-[4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-[5-(2-methylprop-2-enoyloxy)pentoxy]benzoate (PubChem CID 135244375) has the molecular formula C37H44O12 and a molecular weight of 680.75 g/mol. Its IUPAC name is [(3R,6R)-6-[4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-[5-(2-methylprop-2-enoyloxy)pentoxy]benzoate.
| Compound Name | [(3R,6R)-6-[4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-[5-(2-methylprop-2-enoyloxy)pentoxy]benzoate |
|---|---|
| PubChem CID | 135244375 |
| Molecular Formula | C37H44O12 |
| Molecular Weight | 680.75 g/mol |
| Exact Mass | 680.28 |
| IUPAC Name | [(3R,6R)-6-[4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-[5-(2-methylprop-2-enoyloxy)pentoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCCCCOc1ccc(C(=O)O[C@@H]2COC3C2OC[C@H]3OC(=O)c2ccc(OCCCCOC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C37H44O12/c1-24(2)34(38)44-20-7-5-6-18-42-28-14-10-26(11-15-28)36(40)48-30-22-46-33-31(23-47-32(30)33)49-37(41)27-12-16-29(17-13-27)43-19-8-9-21-45-35(39)25(3)4/h10-17,30-33H,1,3,5-9,18-23H2,2,4H3/t30-,31-,32?,33?/m1/s1 |
| InChIKey | MSFWHHAKAQXNQP-AOQDKHGRSA-N |
| XLogP | 5.18 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.75 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|