C34H38O12 — CID 66690293
[(3R,3aR,6R,6aR)-6-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-(4-prop-2-enoyloxybutoxy)benzoate (PubChem CID 66690293) has the molecular formula C34H38O12 and a molecular weight of 638.67 g/mol. Its IUPAC name is [(3R,3aR,6R,6aR)-6-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-(4-prop-2-enoyloxybutoxy)benzoate.
| Compound Name | [(3R,3aR,6R,6aR)-6-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
|---|---|
| PubChem CID | 66690293 |
| Molecular Formula | C34H38O12 |
| Molecular Weight | 638.67 g/mol |
| Exact Mass | 638.24 |
| IUPAC Name | [(3R,3aR,6R,6aR)-6-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)O[C@@H]2CO[C@H]3[C@@H]2OC[C@H]3OC(=O)c2ccc(OCCCCOC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C34H38O12/c1-3-29(35)41-19-7-5-17-39-25-13-9-23(10-14-25)33(37)45-27-21-43-32-28(22-44-31(27)32)46-34(38)24-11-15-26(16-12-24)40-18-6-8-20-42-30(36)4-2/h3-4,9-16,27-28,31-32H,1-2,5-8,17-22H2/t27-,28-,31-,32-/m1/s1 |
| InChIKey | LHRBRJNVYDFKJG-QWWQXMGCSA-N |
| XLogP | 4.01 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.67 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|