C36H34O14 — CID 58981514
[(3S,6S)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-[4-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoyl]oxybenzoyl]oxybenzoate (PubChem CID 58981514) has the molecular formula C36H34O14 and a molecular weight of 690.65 g/mol. Its IUPAC name is [(3S,6S)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-[4-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoyl]oxybenzoyl]oxybenzoate.
| Compound Name | [(3S,6S)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-[4-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoyl]oxybenzoyl]oxybenzoate |
|---|---|
| PubChem CID | 58981514 |
| Molecular Formula | C36H34O14 |
| Molecular Weight | 690.65 g/mol |
| Exact Mass | 690.19 |
| IUPAC Name | [(3S,6S)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-[4-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoyl]oxybenzoyl]oxybenzoate |
| SMILES | C=CC(=O)OCCCCOC(=O)Oc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(C(=O)O[C@H]4COC5C4OC[C@@H]5OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H34O14/c1-3-30(37)43-18-4-5-19-44-36(41)49-27-16-10-23(11-17-27)34(39)47-25-12-6-22(7-13-25)33(38)48-26-14-8-24(9-15-26)35(40)50-29-21-46-31-28(42-2)20-45-32(29)31/h3,6-17,28-29,31-32H,1,4-5,18-21H2,2H3/t28-,29-,31?,32?/m0/s1 |
| InChIKey | RMSSLQIVGPZVRP-SYGBTZKXSA-N |
| XLogP | 4.49 |
| TPSA | 168.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.65 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|