C22H26O9 — CID 89352833
[(3S)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoate (PubChem CID 89352833) has the molecular formula C22H26O9 and a molecular weight of 434.44 g/mol. Its IUPAC name is [(3S)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoate.
| Compound Name | [(3S)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoate |
|---|---|
| PubChem CID | 89352833 |
| Molecular Formula | C22H26O9 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | [(3S)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoate |
| SMILES | C=CC(=O)OCCCCOC(=O)Oc1ccc(C(=O)OC2COC3C2OC[C@@H]3C)cc1 |
| InChI | InChI=1S/C22H26O9/c1-3-18(23)26-10-4-5-11-27-22(25)30-16-8-6-15(7-9-16)21(24)31-17-13-29-19-14(2)12-28-20(17)19/h3,6-9,14,17,19-20H,1,4-5,10-13H2,2H3/t14-,17?,19?,20?/m0/s1 |
| InChIKey | KCGGASZJSFQRDK-PRZQFHMXSA-N |
| XLogP | 2.67 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|