C32H34O13 — CID 58890249
[(3R,6S)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-[4-(6-prop-2-enoyloxyhexoxycarbonyloxy)benzoyl]oxybenzoate (PubChem CID 58890249) has the molecular formula C32H34O13 and a molecular weight of 626.61 g/mol. Its IUPAC name is [(3R,6S)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-[4-(6-prop-2-enoyloxyhexoxycarbonyloxy)benzoyl]oxybenzoate.
| Compound Name | [(3R,6S)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-[4-(6-prop-2-enoyloxyhexoxycarbonyloxy)benzoyl]oxybenzoate |
|---|---|
| PubChem CID | 58890249 |
| Molecular Formula | C32H34O13 |
| Molecular Weight | 626.61 g/mol |
| Exact Mass | 626.20 |
| IUPAC Name | [(3R,6S)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-[4-(6-prop-2-enoyloxyhexoxycarbonyloxy)benzoyl]oxybenzoate |
| SMILES | C=CC(=O)OCCCCCCOC(=O)Oc1ccc(C(=O)Oc2ccc(C(=O)O[C@H]3COC4C3OC[C@H]4OC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C32H34O13/c1-3-27(34)38-16-6-4-5-7-17-39-32(37)44-24-14-10-21(11-15-24)30(35)43-23-12-8-22(9-13-23)31(36)45-26-19-41-28-25(42-20(2)33)18-40-29(26)28/h3,8-15,25-26,28-29H,1,4-7,16-19H2,2H3/t25-,26+,28?,29?/m1/s1 |
| InChIKey | SHGWEKRHPRLPQL-UJDQGEGXSA-N |
| XLogP | 3.97 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|