C36H38O16 — CID 89264192
[(6R)-6-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoate (PubChem CID 89264192) has the molecular formula C36H38O16 and a molecular weight of 726.68 g/mol. Its IUPAC name is [(6R)-6-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoate.
| Compound Name | [(6R)-6-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoate |
|---|---|
| PubChem CID | 89264192 |
| Molecular Formula | C36H38O16 |
| Molecular Weight | 726.68 g/mol |
| Exact Mass | 726.22 |
| IUPAC Name | [(6R)-6-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoate |
| SMILES | C=CC(=O)OCCCCOC(=O)Oc1ccc(C(=O)OC2COC3C2OC[C@H]3OC(=O)c2ccc(OC(=O)OCCCCOC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C36H38O16/c1-3-29(37)43-17-5-7-19-45-35(41)49-25-13-9-23(10-14-25)33(39)51-27-21-47-32-28(22-48-31(27)32)52-34(40)24-11-15-26(16-12-24)50-36(42)46-20-8-6-18-44-30(38)4-2/h3-4,9-16,27-28,31-32H,1-2,5-8,17-22H2/t27-,28?,31?,32?/m1/s1 |
| InChIKey | NNQWBEAYVVNMQD-FOPJIALISA-N |
| XLogP | 4.28 |
| TPSA | 194.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.68 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|