C38H42O14 — CID 58982824
[(3R,3aR,6R,6aR)-6-[4-(6-prop-2-enoyloxyhexanoyloxy)benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-(6-prop-2-enoyloxyhexanoyloxy)benzoate (PubChem CID 58982824) has the molecular formula C38H42O14 and a molecular weight of 722.74 g/mol. Its IUPAC name is [(3R,3aR,6R,6aR)-6-[4-(6-prop-2-enoyloxyhexanoyloxy)benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-(6-prop-2-enoyloxyhexanoyloxy)benzoate.
| Compound Name | [(3R,3aR,6R,6aR)-6-[4-(6-prop-2-enoyloxyhexanoyloxy)benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-(6-prop-2-enoyloxyhexanoyloxy)benzoate |
|---|---|
| PubChem CID | 58982824 |
| Molecular Formula | C38H42O14 |
| Molecular Weight | 722.74 g/mol |
| Exact Mass | 722.26 |
| IUPAC Name | [(3R,3aR,6R,6aR)-6-[4-(6-prop-2-enoyloxyhexanoyloxy)benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-(6-prop-2-enoyloxyhexanoyloxy)benzoate |
| SMILES | C=CC(=O)OCCCCCC(=O)Oc1ccc(C(=O)O[C@@H]2CO[C@H]3[C@@H]2OC[C@H]3OC(=O)c2ccc(OC(=O)CCCCCOC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C38H42O14/c1-3-31(39)45-21-9-5-7-11-33(41)49-27-17-13-25(14-18-27)37(43)51-29-23-47-36-30(24-48-35(29)36)52-38(44)26-15-19-28(20-16-26)50-34(42)12-8-6-10-22-46-32(40)4-2/h3-4,13-20,29-30,35-36H,1-2,5-12,21-24H2/t29-,30-,35-,36-/m1/s1 |
| InChIKey | QIJBNMWLKSUHBC-VONQXTHZSA-N |
| XLogP | 4.63 |
| TPSA | 176.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.74 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|