C35H34O14 — CID 58232623
[4-[[(3R,6R)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonyl]-2-methoxyphenyl] 6-(4-prop-2-enoyloxybutoxycarbonyloxy)naphthalene-2-carboxylate (PubChem CID 58232623) has the molecular formula C35H34O14 and a molecular weight of 678.64 g/mol. Its IUPAC name is [4-[[(3R,6R)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonyl]-2-methoxyphenyl] 6-(4-prop-2-enoyloxybutoxycarbonyloxy)naphthalene-2-carboxylate.
| Compound Name | [4-[[(3R,6R)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonyl]-2-methoxyphenyl] 6-(4-prop-2-enoyloxybutoxycarbonyloxy)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 58232623 |
| Molecular Formula | C35H34O14 |
| Molecular Weight | 678.64 g/mol |
| Exact Mass | 678.19 |
| IUPAC Name | [4-[[(3R,6R)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonyl]-2-methoxyphenyl] 6-(4-prop-2-enoyloxybutoxycarbonyloxy)naphthalene-2-carboxylate |
| SMILES | C=CC(=O)OCCCCOC(=O)Oc1ccc2cc(C(=O)Oc3ccc(C(=O)O[C@@H]4COC5C4OC[C@H]5OC(C)=O)cc3OC)ccc2c1 |
| InChI | InChI=1S/C35H34O14/c1-4-30(37)42-13-5-6-14-43-35(40)47-25-11-9-21-15-23(8-7-22(21)16-25)33(38)48-26-12-10-24(17-27(26)41-3)34(39)49-29-19-45-31-28(46-20(2)36)18-44-32(29)31/h4,7-12,15-17,28-29,31-32H,1,5-6,13-14,18-19H2,2-3H3/t28-,29-,31?,32?/m1/s1 |
| InChIKey | VTLDLUUEIFWKHB-DUEBYIIVSA-N |
| XLogP | 4.35 |
| TPSA | 168.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.64 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|