C16H20O5 — CID 58785408
methyl 4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoate (PubChem CID 58785408) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is methyl 4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoate.
| Compound Name | methyl 4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoate |
|---|---|
| PubChem CID | 58785408 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | methyl 4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCCCOc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C16H20O5/c1-12(2)15(17)21-11-5-4-10-20-14-8-6-13(7-9-14)16(18)19-3/h6-9H,1,4-5,10-11H2,2-3H3 |
| InChIKey | PGLCPMZBIRCEAC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|