C23H32O6 — CID 122605836
6-(4-acetylphenoxy)hexyl 5-(2-methylprop-2-enoyloxy)pentanoate (PubChem CID 122605836) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is 6-(4-acetylphenoxy)hexyl 5-(2-methylprop-2-enoyloxy)pentanoate.
| Compound Name | 6-(4-acetylphenoxy)hexyl 5-(2-methylprop-2-enoyloxy)pentanoate |
|---|---|
| PubChem CID | 122605836 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 6-(4-acetylphenoxy)hexyl 5-(2-methylprop-2-enoyloxy)pentanoate |
| SMILES | C=C(C)C(=O)OCCCCC(=O)OCCCCCCOc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C23H32O6/c1-18(2)23(26)29-17-9-6-10-22(25)28-16-8-5-4-7-15-27-21-13-11-20(12-14-21)19(3)24/h11-14H,1,4-10,15-17H2,2-3H3 |
| InChIKey | XHYJMVUVEGFYFJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|