C25H38O5 — CID 58019571
8-(4-methylphenoxy)octyl 6-(2-methylprop-2-enoyloxy)hexanoate (PubChem CID 58019571) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is 8-(4-methylphenoxy)octyl 6-(2-methylprop-2-enoyloxy)hexanoate.
| Compound Name | 8-(4-methylphenoxy)octyl 6-(2-methylprop-2-enoyloxy)hexanoate |
|---|---|
| PubChem CID | 58019571 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 8-(4-methylphenoxy)octyl 6-(2-methylprop-2-enoyloxy)hexanoate |
| SMILES | C=C(C)C(=O)OCCCCCC(=O)OCCCCCCCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C25H38O5/c1-21(2)25(27)30-20-12-8-9-13-24(26)29-19-11-7-5-4-6-10-18-28-23-16-14-22(3)15-17-23/h14-17H,1,4-13,18-20H2,2-3H3 |
| InChIKey | NYWUCBDDTAOVHD-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|