C27H28O3 — CID 118375334
6-[4-[4-(4-methylphenyl)buta-1,3-diynyl]phenoxy]hexyl 2-methylprop-2-enoate (PubChem CID 118375334) has the molecular formula C27H28O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 6-[4-[4-(4-methylphenyl)buta-1,3-diynyl]phenoxy]hexyl 2-methylprop-2-enoate.
| Compound Name | 6-[4-[4-(4-methylphenyl)buta-1,3-diynyl]phenoxy]hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118375334 |
| Molecular Formula | C27H28O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 6-[4-[4-(4-methylphenyl)buta-1,3-diynyl]phenoxy]hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(C#CC#Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H28O3/c1-22(2)27(28)30-21-9-5-4-8-20-29-26-18-16-25(17-19-26)11-7-6-10-24-14-12-23(3)13-15-24/h12-19H,1,4-5,8-9,20-21H2,2-3H3 |
| InChIKey | GPJGNKPLGAQUNQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|