C26H30O6S — CID 59739169
3-[4-[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]sulfanylphenoxy]propyl 2-methylprop-2-enoate (PubChem CID 59739169) has the molecular formula C26H30O6S and a molecular weight of 470.59 g/mol. Its IUPAC name is 3-[4-[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]sulfanylphenoxy]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[4-[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]sulfanylphenoxy]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59739169 |
| Molecular Formula | C26H30O6S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 3-[4-[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]sulfanylphenoxy]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCOc1ccc(Sc2ccc(OCCCOC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C26H30O6S/c1-19(2)25(27)31-17-5-15-29-21-7-11-23(12-8-21)33-24-13-9-22(10-14-24)30-16-6-18-32-26(28)20(3)4/h7-14H,1,3,5-6,15-18H2,2,4H3 |
| InChIKey | ISLDBVVVRPLJMV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|