C22H34O5 — CID 139664490
4-[4-(4-phenoxybutoxy)butoxy]butyl 2-methylprop-2-enoate (PubChem CID 139664490) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is 4-[4-(4-phenoxybutoxy)butoxy]butyl 2-methylprop-2-enoate.
| Compound Name | 4-[4-(4-phenoxybutoxy)butoxy]butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139664490 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 4-[4-(4-phenoxybutoxy)butoxy]butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCOCCCCOCCCCOc1ccccc1 |
| InChI | InChI=1S/C22H34O5/c1-20(2)22(23)27-19-11-9-17-25-15-7-6-14-24-16-8-10-18-26-21-12-4-3-5-13-21/h3-5,12-13H,1,6-11,14-19H2,2H3 |
| InChIKey | RJRFEXHTHMROCG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|