C24H30O4 — CID 139671734
4-[4-(2-phenylphenoxy)butoxy]butyl 2-methylprop-2-enoate (PubChem CID 139671734) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is 4-[4-(2-phenylphenoxy)butoxy]butyl 2-methylprop-2-enoate.
| Compound Name | 4-[4-(2-phenylphenoxy)butoxy]butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139671734 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 4-[4-(2-phenylphenoxy)butoxy]butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCOCCCCOc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H30O4/c1-20(2)24(25)28-19-11-9-17-26-16-8-10-18-27-23-15-7-6-14-22(23)21-12-4-3-5-13-21/h3-7,12-15H,1,8-11,16-19H2,2H3 |
| InChIKey | VYEHXHSDJJAUHV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|