C50H46O8 — CID 68950295
3-[2-[2-[3-[2-methyl-3-(2-phenylphenoxy)prop-2-enoyl]oxypropoxy]phenyl]phenoxy]propyl 2-methyl-3-(2-phenylphenoxy)prop-2-enoate (PubChem CID 68950295) has the molecular formula C50H46O8 and a molecular weight of 774.91 g/mol. Its IUPAC name is 3-[2-[2-[3-[2-methyl-3-(2-phenylphenoxy)prop-2-enoyl]oxypropoxy]phenyl]phenoxy]propyl 2-methyl-3-(2-phenylphenoxy)prop-2-enoate.
| Compound Name | 3-[2-[2-[3-[2-methyl-3-(2-phenylphenoxy)prop-2-enoyl]oxypropoxy]phenyl]phenoxy]propyl 2-methyl-3-(2-phenylphenoxy)prop-2-enoate |
|---|---|
| PubChem CID | 68950295 |
| Molecular Formula | C50H46O8 |
| Molecular Weight | 774.91 g/mol |
| Exact Mass | 774.32 |
| IUPAC Name | 3-[2-[2-[3-[2-methyl-3-(2-phenylphenoxy)prop-2-enoyl]oxypropoxy]phenyl]phenoxy]propyl 2-methyl-3-(2-phenylphenoxy)prop-2-enoate |
| SMILES | CC(=COc1ccccc1-c1ccccc1)C(=O)OCCCOc1ccccc1-c1ccccc1OCCCOC(=O)C(C)=COc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C50H46O8/c1-37(35-57-45-27-13-9-23-41(45)39-19-5-3-6-20-39)49(51)55-33-17-31-53-47-29-15-11-25-43(47)44-26-12-16-30-48(44)54-32-18-34-56-50(52)38(2)36-58-46-28-14-10-24-42(46)40-21-7-4-8-22-40/h3-16,19-30,35-36H,17-18,31-34H2,1-2H3 |
| InChIKey | NZUOODGVIAINDW-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.91 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|