C54H54O8 — CID 68949160
3-[4-[3,5-dimethyl-4-[3-[2-methyl-3-(2-phenylphenoxy)prop-2-enoyl]oxypropoxy]phenyl]-2,6-dimethylphenoxy]propyl 2-methyl-3-(2-phenylphenoxy)prop-2-enoate (PubChem CID 68949160) has the molecular formula C54H54O8 and a molecular weight of 831.02 g/mol. Its IUPAC name is 3-[4-[3,5-dimethyl-4-[3-[2-methyl-3-(2-phenylphenoxy)prop-2-enoyl]oxypropoxy]phenyl]-2,6-dimethylphenoxy]propyl 2-methyl-3-(2-phenylphenoxy)prop-2-enoate.
| Compound Name | 3-[4-[3,5-dimethyl-4-[3-[2-methyl-3-(2-phenylphenoxy)prop-2-enoyl]oxypropoxy]phenyl]-2,6-dimethylphenoxy]propyl 2-methyl-3-(2-phenylphenoxy)prop-2-enoate |
|---|---|
| PubChem CID | 68949160 |
| Molecular Formula | C54H54O8 |
| Molecular Weight | 831.02 g/mol |
| Exact Mass | 830.38 |
| IUPAC Name | 3-[4-[3,5-dimethyl-4-[3-[2-methyl-3-(2-phenylphenoxy)prop-2-enoyl]oxypropoxy]phenyl]-2,6-dimethylphenoxy]propyl 2-methyl-3-(2-phenylphenoxy)prop-2-enoate |
| SMILES | CC(=COc1ccccc1-c1ccccc1)C(=O)OCCCOc1c(C)cc(-c2cc(C)c(OCCCOC(=O)C(C)=COc3ccccc3-c3ccccc3)c(C)c2)cc1C |
| InChI | InChI=1S/C54H54O8/c1-37-31-45(32-38(2)51(37)57-27-17-29-59-53(55)41(5)35-61-49-25-15-13-23-47(49)43-19-9-7-10-20-43)46-33-39(3)52(40(4)34-46)58-28-18-30-60-54(56)42(6)36-62-50-26-16-14-24-48(50)44-21-11-8-12-22-44/h7-16,19-26,31-36H,17-18,27-30H2,1-6H3 |
| InChIKey | RGIDLHOHNVHQFE-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.02 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|