C13H16O4 — CID 57110503
propyl 3-(2-hydroxyphenoxy)-2-methylprop-2-enoate (PubChem CID 57110503) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is propyl 3-(2-hydroxyphenoxy)-2-methylprop-2-enoate.
| Compound Name | propyl 3-(2-hydroxyphenoxy)-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 57110503 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | propyl 3-(2-hydroxyphenoxy)-2-methylprop-2-enoate |
| SMILES | CCCOC(=O)C(C)=COc1ccccc1O |
| InChI | InChI=1S/C13H16O4/c1-3-8-16-13(15)10(2)9-17-12-7-5-4-6-11(12)14/h4-7,9,14H,3,8H2,1-2H3 |
| InChIKey | MPBVKKCJOWPHBY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|