C13H12O7 — CID 141075910
(E)-4-[2-(2-hydroxyphenoxy)-2-oxoethoxy]-3-methyl-4-oxobut-2-enoic acid (PubChem CID 141075910) has the molecular formula C13H12O7 and a molecular weight of 280.23 g/mol. Its IUPAC name is (E)-4-[2-(2-hydroxyphenoxy)-2-oxoethoxy]-3-methyl-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-(2-hydroxyphenoxy)-2-oxoethoxy]-3-methyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 141075910 |
| Molecular Formula | C13H12O7 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | (E)-4-[2-(2-hydroxyphenoxy)-2-oxoethoxy]-3-methyl-4-oxobut-2-enoic acid |
| SMILES | C/C(=C\C(=O)O)C(=O)OCC(=O)Oc1ccccc1O |
| InChI | InChI=1S/C13H12O7/c1-8(6-11(15)16)13(18)19-7-12(17)20-10-5-3-2-4-9(10)14/h2-6,14H,7H2,1H3,(H,15,16)/b8-6+ |
| InChIKey | VVDKBRVHXORYSU-SOFGYWHQSA-N |
| XLogP | 0.87 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|